C22H28N3O6P — CID 40930001
N-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 40930001) has the molecular formula C22H28N3O6P and a molecular weight of 461.46 g/mol. Its IUPAC name is N-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 40930001 |
| Molecular Formula | C22H28N3O6P |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCOP(=O)(OCC)[C@@H](NC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C22H28N3O6P/c1-3-30-32(29,31-4-2)22(17-10-6-5-7-11-17)23-21(26)18-12-13-19(20(16-18)25(27)28)24-14-8-9-15-24/h5-7,10-13,16,22H,3-4,8-9,14-15H2,1-2H3,(H,23,26)/t22-/m1/s1 |
| InChIKey | WJQYJBJGKUJEMH-JOCHJYFZSA-N |
| XLogP | 4.89 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|