C20H16N4O5S2 — CID 40939321
[(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(methylamino)-5-nitrobenzoate (PubChem CID 40939321) has the molecular formula C20H16N4O5S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(methylamino)-5-nitrobenzoate.
| Compound Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(methylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 40939321 |
| Molecular Formula | C20H16N4O5S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] 2-(methylamino)-5-nitrobenzoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)O[C@H](C)c1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H16N4O5S2/c1-10(29-20(26)12-8-11(24(27)28)5-6-14(12)21-2)17-22-18(25)16-13(9-31-19(16)23-17)15-4-3-7-30-15/h3-10,21H,1-2H3,(H,22,23,25)/t10-/m1/s1 |
| InChIKey | DKWLHBUAJBPVTK-SNVBAGLBSA-N |
| XLogP | 4.58 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|