C20H22N6O4S — CID 40943662
1-[(3R)-1,1-dioxothiolan-3-yl]-7,9-dimethyl-3-(4-methylphenyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 40943662) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-7,9-dimethyl-3-(4-methylphenyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-7,9-dimethyl-3-(4-methylphenyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 40943662 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-7,9-dimethyl-3-(4-methylphenyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | Cc1ccc(C2=NN([C@@H]3CCS(=O)(=O)C3)c3nc4c(c(=O)n(C)c(=O)n4C)n3C2)cc1 |
| InChI | InChI=1S/C20H22N6O4S/c1-12-4-6-13(7-5-12)15-10-25-16-17(23(2)20(28)24(3)18(16)27)21-19(25)26(22-15)14-8-9-31(29,30)11-14/h4-7,14H,8-11H2,1-3H3/t14-/m1/s1 |
| InChIKey | WULYNNNIZKNIFQ-CQSZACIVSA-N |
| XLogP | 0.15 |
| TPSA | 111.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |