C26H23FN4O3 — CID 40953381
(5S)-3-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 40953381) has the molecular formula C26H23FN4O3 and a molecular weight of 458.49 g/mol. Its IUPAC name is (5S)-3-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40953381 |
| Molecular Formula | C26H23FN4O3 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (5S)-3-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C2=O)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN4O3/c1-15-11-21(16(2)31(15)19-9-7-18(27)8-10-19)24(32)14-30-25(33)23(29-26(30)34)12-17-13-28-22-6-4-3-5-20(17)22/h3-11,13,23,28H,12,14H2,1-2H3,(H,29,34)/t23-/m0/s1 |
| InChIKey | MFTBTINAEIHLCO-QHCPKHFHSA-N |
| XLogP | 4.06 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|