C21H19FN4O2 — CID 40954034
(2S)-2-(4-cyanophenoxy)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide (PubChem CID 40954034) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is (2S)-2-(4-cyanophenoxy)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide.
| Compound Name | (2S)-2-(4-cyanophenoxy)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 40954034 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2S)-2-(4-cyanophenoxy)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)N[C@@H](c1ccccc1F)c1nccn1C |
| InChI | InChI=1S/C21H19FN4O2/c1-14(28-16-9-7-15(13-23)8-10-16)21(27)25-19(20-24-11-12-26(20)2)17-5-3-4-6-18(17)22/h3-12,14,19H,1-2H3,(H,25,27)/t14-,19-/m0/s1 |
| InChIKey | UTYAMXXVJYVKHJ-LIRRHRJNSA-N |
| XLogP | 3.10 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |