C21H20N4O5S — CID 40957473
N-[5-(1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]-4-(diethylsulfamoyl)benzamide (PubChem CID 40957473) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[5-(1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[5-(1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 40957473 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[5-(1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(-c3cc4ccccc4o3)o2)cc1 |
| InChI | InChI=1S/C21H20N4O5S/c1-3-25(4-2)31(27,28)16-11-9-14(10-12-16)19(26)22-21-24-23-20(30-21)18-13-15-7-5-6-8-17(15)29-18/h5-13H,3-4H2,1-2H3,(H,22,24,26) |
| InChIKey | NJARJTVAXTUDGG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |