C24H21FN4O4S — CID 43971896
4-[benzyl(ethyl)sulfamoyl]-N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 43971896) has the molecular formula C24H21FN4O4S and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43971896 |
| Molecular Formula | C24H21FN4O4S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nnc(-c3cccc(F)c3)o2)cc1 |
| InChI | InChI=1S/C24H21FN4O4S/c1-2-29(16-17-7-4-3-5-8-17)34(31,32)21-13-11-18(12-14-21)22(30)26-24-28-27-23(33-24)19-9-6-10-20(25)15-19/h3-15H,2,16H2,1H3,(H,26,28,30) |
| InChIKey | UCBBFBPSFZOPRM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |