C20H20ClN3O3S2 — CID 40958226
4-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]benzamide (PubChem CID 40958226) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 4-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 40958226 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]benzamide |
| SMILES | O=C(NC1=NCCS1)c1ccc(Cl)c(S(=O)(=O)N[C@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c21-16-9-8-14(19(25)23-20-22-10-11-28-20)12-18(16)29(26,27)24-17-7-3-5-13-4-1-2-6-15(13)17/h1-2,4,6,8-9,12,17,24H,3,5,7,10-11H2,(H,22,23,25)/t17-/m0/s1 |
| InChIKey | FOZNRUBLBFCBPO-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |