C20H19ClFNO3 — CID 40960869
(3-fluorophenyl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate (PubChem CID 40960869) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate.
| Compound Name | (3-fluorophenyl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 40960869 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3-fluorophenyl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate |
| SMILES | O=C(OCc1cccc(F)c1)[C@@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClFNO3/c21-17-8-6-15(7-9-17)19(24)23-10-2-4-16(12-23)20(25)26-13-14-3-1-5-18(22)11-14/h1,3,5-9,11,16H,2,4,10,12-13H2/t16-/m1/s1 |
| InChIKey | LOOGHLQKXCXGJL-MRXNPFEDSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |