C21H22N2O5S3 — CID 40963326
ethyl 2-[[2-[(5R)-3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 40963326) has the molecular formula C21H22N2O5S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is ethyl 2-[[2-[(5R)-3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(5R)-3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 40963326 |
| Molecular Formula | C21H22N2O5S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | ethyl 2-[[2-[(5R)-3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C[C@H]2SC(=S)N(Cc3ccco3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C21H22N2O5S3/c1-2-27-20(26)17-13-7-3-4-8-14(13)30-18(17)22-16(24)10-15-19(25)23(21(29)31-15)11-12-6-5-9-28-12/h5-6,9,15H,2-4,7-8,10-11H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | QCDNXIWVXVVPBT-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|