C29H28N2O6S3 — CID 18807788
ethyl 2-[[2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18807788) has the molecular formula C29H28N2O6S3 and a molecular weight of 596.75 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18807788 |
| Molecular Formula | C29H28N2O6S3 |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | ethyl 2-[[2-[4-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2ccc(/C=C3\SC(=S)N(Cc4ccco4)C3=O)cc2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C29H28N2O6S3/c1-3-35-28(34)25-21-11-6-17(2)13-22(21)39-26(25)30-24(32)16-37-19-9-7-18(8-10-19)14-23-27(33)31(29(38)40-23)15-20-5-4-12-36-20/h4-5,7-10,12,14,17H,3,6,11,13,15-16H2,1-2H3,(H,30,32)/b23-14- |
| InChIKey | BTJSIEDRXIVGFW-UCQKPKSFSA-N |
| XLogP | 6.06 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|