C24H24N2O5S3 — CID 4069934
ethyl 2-[[2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4069934) has the molecular formula C24H24N2O5S3 and a molecular weight of 516.67 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4069934 |
| Molecular Formula | C24H24N2O5S3 |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | ethyl 2-[[2-[5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)C(=Cc3ccc(OC)cc3)SC2=S)sc2c1CCCC2 |
| InChI | InChI=1S/C24H24N2O5S3/c1-3-31-23(29)20-16-6-4-5-7-17(16)33-21(20)25-19(27)13-26-22(28)18(34-24(26)32)12-14-8-10-15(30-2)11-9-14/h8-12H,3-7,13H2,1-2H3,(H,25,27) |
| InChIKey | HDCWHKBRADBAKX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|