C33H34N2O7S2 — CID 3561259
ethyl 2-[[2-[5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3561259) has the molecular formula C33H34N2O7S2 and a molecular weight of 634.78 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3561259 |
| Molecular Formula | C33H34N2O7S2 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | ethyl 2-[[2-[5-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)SC(=Cc3ccc(OCc4cccc(C)c4)c(OCC)c3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C33H34N2O7S2/c1-4-40-25-16-21(13-14-24(25)42-19-22-10-8-9-20(3)15-22)17-27-31(37)35(33(39)44-27)18-28(36)34-30-29(32(38)41-5-2)23-11-6-7-12-26(23)43-30/h8-10,13-17H,4-7,11-12,18-19H2,1-3H3,(H,34,36) |
| InChIKey | LGNFVZKWERFWSR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|