C23H21FN2O5S2 — CID 1272456
ethyl 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 1272456) has the molecular formula C23H21FN2O5S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1272456 |
| Molecular Formula | C23H21FN2O5S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | ethyl 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)SC(=Cc3ccc(F)cc3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C23H21FN2O5S2/c1-2-31-22(29)19-15-5-3-4-6-16(15)32-20(19)25-18(27)12-26-21(28)17(33-23(26)30)11-13-7-9-14(24)10-8-13/h7-11H,2-6,12H2,1H3,(H,25,27) |
| InChIKey | MKZQKHVPRZSDQL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|