C21H18FN3O4S2 — CID 2860793
2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2860793) has the molecular formula C21H18FN3O4S2 and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2860793 |
| Molecular Formula | C21H18FN3O4S2 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-[[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CN2C(=O)SC(=Cc3ccc(F)cc3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C21H18FN3O4S2/c22-12-7-5-11(6-8-12)9-15-20(28)25(21(29)31-15)10-16(26)24-19-17(18(23)27)13-3-1-2-4-14(13)30-19/h5-9H,1-4,10H2,(H2,23,27)(H,24,26) |
| InChIKey | UOIQOFHMDJCAQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|