C22H20ClN3O3S3 — CID 6201122
2-[3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 6201122) has the molecular formula C22H20ClN3O3S3 and a molecular weight of 506.07 g/mol. Its IUPAC name is 2-[3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 6201122 |
| Molecular Formula | C22H20ClN3O3S3 |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 2-[3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CCN2C(=O)/C(=C/c3ccccc3Cl)SC2=S)sc2c1CCCC2 |
| InChI | InChI=1S/C22H20ClN3O3S3/c23-14-7-3-1-5-12(14)11-16-21(29)26(22(30)32-16)10-9-17(27)25-20-18(19(24)28)13-6-2-4-8-15(13)31-20/h1,3,5,7,11H,2,4,6,8-10H2,(H2,24,28)(H,25,27)/b16-11- |
| InChIKey | CLSZQUYBDQUQIE-WJDWOHSUSA-N |
| XLogP | 4.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|