C25H26N2O5S3 — CID 4756754
ethyl 2-[[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4756754) has the molecular formula C25H26N2O5S3 and a molecular weight of 530.69 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4756754 |
| Molecular Formula | C25H26N2O5S3 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | ethyl 2-[[2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)C(=Cc3ccc(OCC)cc3)SC2=S)sc2c1CCCC2 |
| InChI | InChI=1S/C25H26N2O5S3/c1-3-31-16-11-9-15(10-12-16)13-19-23(29)27(25(33)35-19)14-20(28)26-22-21(24(30)32-4-2)17-7-5-6-8-18(17)34-22/h9-13H,3-8,14H2,1-2H3,(H,26,28) |
| InChIKey | MQKUUSKSIAJLGI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|