C33H40N2O5S3 — CID 18807753
ethyl 2-[6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18807753) has the molecular formula C33H40N2O5S3 and a molecular weight of 640.89 g/mol. Its IUPAC name is ethyl 2-[6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18807753 |
| Molecular Formula | C33H40N2O5S3 |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | ethyl 2-[6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCCCN2C(=O)/C(=C/c3ccc(OC4CCCCC4)cc3)SC2=S)sc2c1CCCC2 |
| InChI | InChI=1S/C33H40N2O5S3/c1-2-39-32(38)29-25-13-8-9-14-26(25)42-30(29)34-28(36)15-7-4-10-20-35-31(37)27(43-33(35)41)21-22-16-18-24(19-17-22)40-23-11-5-3-6-12-23/h16-19,21,23H,2-15,20H2,1H3,(H,34,36)/b27-21- |
| InChIKey | BNYYIWJPEDTESF-MEFGMAGPSA-N |
| XLogP | 7.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|