C29H35N3O3S3 — CID 18808061
6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 18808061) has the molecular formula C29H35N3O3S3 and a molecular weight of 569.82 g/mol. Its IUPAC name is 6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | 6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 18808061 |
| Molecular Formula | C29H35N3O3S3 |
| Molecular Weight | 569.82 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 6-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2ccc(OC3CCCCC3)cc2)SC1=S)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C29H35N3O3S3/c33-26(31-28-30-23-11-6-7-12-24(23)37-28)13-5-2-8-18-32-27(34)25(38-29(32)36)19-20-14-16-22(17-15-20)35-21-9-3-1-4-10-21/h14-17,19,21H,1-13,18H2,(H,30,31,33)/b25-19- |
| InChIKey | WPYMMFAPPVGLKL-PLRJNAJWSA-N |
| XLogP | 7.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.82 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|