C29H31N3O3S3 — CID 18807928
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 18807928) has the molecular formula C29H31N3O3S3 and a molecular weight of 565.79 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 18807928 |
| Molecular Formula | C29H31N3O3S3 |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-[(5Z)-5-[(4-cyclohexyloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | N#Cc1c(NC(=O)CCCN2C(=O)/C(=C/c3ccc(OC4CCCCC4)cc3)SC2=S)sc2c1CCCC2 |
| InChI | InChI=1S/C29H31N3O3S3/c30-18-23-22-9-4-5-10-24(22)37-27(23)31-26(33)11-6-16-32-28(34)25(38-29(32)36)17-19-12-14-21(15-13-19)35-20-7-2-1-3-8-20/h12-15,17,20H,1-11,16H2,(H,31,33)/b25-17- |
| InChIKey | RFTOBXIFCRBCGH-UQQQWYQISA-N |
| XLogP | 6.83 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|