C31H28Cl2N2O7S2 — CID 4270163
ethyl 2-[[2-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4270163) has the molecular formula C31H28Cl2N2O7S2 and a molecular weight of 675.61 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4270163 |
| Molecular Formula | C31H28Cl2N2O7S2 |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 674.07 |
| IUPAC Name | ethyl 2-[[2-[5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)SC(=Cc3ccc(OCc4ccc(Cl)cc4Cl)c(OC)c3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C31H28Cl2N2O7S2/c1-3-41-30(38)27-20-6-4-5-7-24(20)43-28(27)34-26(36)15-35-29(37)25(44-31(35)39)13-17-8-11-22(23(12-17)40-2)42-16-18-9-10-19(32)14-21(18)33/h8-14H,3-7,15-16H2,1-2H3,(H,34,36) |
| InChIKey | JSOGSLJDKXGGPP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|