C31H29N3O9S2 — CID 4030998
ethyl 2-[[2-[5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4030998) has the molecular formula C31H29N3O9S2 and a molecular weight of 651.72 g/mol. Its IUPAC name is ethyl 2-[[2-[5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4030998 |
| Molecular Formula | C31H29N3O9S2 |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | ethyl 2-[[2-[5-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)SC(=Cc3cc(OC)c(OCc4ccccc4)cc3[N+](=O)[O-])C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C31H29N3O9S2/c1-3-42-30(37)27-20-11-7-8-12-24(20)44-28(27)32-26(35)16-33-29(36)25(45-31(33)38)14-19-13-22(41-2)23(15-21(19)34(39)40)43-17-18-9-5-4-6-10-18/h4-6,9-10,13-15H,3,7-8,11-12,16-17H2,1-2H3,(H,32,35) |
| InChIKey | RYZCIRGKIPMUAY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|