C18H19N3O4S — CID 40963378
(2Z,5R)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-methyl-1,3-thiazolidin-4-one (PubChem CID 40963378) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2Z,5R)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40963378 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2Z,5R)-2-[(E)-(2,4-dimethoxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=N/N=C2\S[C@H](C)C(=O)N2Cc2ccco2)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12-17(22)21(11-15-5-4-8-25-15)18(26-12)20-19-10-13-6-7-14(23-2)9-16(13)24-3/h4-10,12H,11H2,1-3H3/b19-10+,20-18-/t12-/m1/s1 |
| InChIKey | CZYKRHNTVYQSHZ-JYZLKHOLSA-N |
| XLogP | 3.15 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|