C18H16N4O3S — CID 40972063
(4S)-11,13-dimethyl-4-(4-methyl-3-nitrophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one (PubChem CID 40972063) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is (4S)-11,13-dimethyl-4-(4-methyl-3-nitrophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one.
| Compound Name | (4S)-11,13-dimethyl-4-(4-methyl-3-nitrophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
|---|---|
| PubChem CID | 40972063 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (4S)-11,13-dimethyl-4-(4-methyl-3-nitrophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
| SMILES | Cc1cc(C)c2c3c(sc2n1)C(=O)N[C@@H](c1ccc(C)c([N+](=O)[O-])c1)N3 |
| InChI | InChI=1S/C18H16N4O3S/c1-8-4-5-11(7-12(8)22(24)25)16-20-14-13-9(2)6-10(3)19-18(13)26-15(14)17(23)21-16/h4-7,16,20H,1-3H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | WYYHHYTZMBRTFF-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|