C20H16N4O4S2 — CID 40998598
2-methyl-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-5-nitrobenzenesulfonamide (PubChem CID 40998598) has the molecular formula C20H16N4O4S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-methyl-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-methyl-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 40998598 |
| Molecular Formula | C20H16N4O4S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 2-methyl-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1cccc(-c2nc3cccnc3s2)c1C |
| InChI | InChI=1S/C20H16N4O4S2/c1-12-8-9-14(24(25)26)11-18(12)30(27,28)23-16-6-3-5-15(13(16)2)19-22-17-7-4-10-21-20(17)29-19/h3-11,23H,1-2H3 |
| InChIKey | AIMJNIOXBZGDQE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|