C33H34N2O3 — CID 41000522
(6R)-6-(4-tert-butylphenyl)-9,9-dimethyl-5-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 41000522) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is (6R)-6-(4-tert-butylphenyl)-9,9-dimethyl-5-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R)-6-(4-tert-butylphenyl)-9,9-dimethyl-5-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 41000522 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (6R)-6-(4-tert-butylphenyl)-9,9-dimethyl-5-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N([C@H]1OC(=O)c3ccccc31)[C@@H]2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H34N2O3/c1-32(2,3)21-16-14-20(15-17-21)29-28-25(18-33(4,5)19-27(28)36)34-24-12-8-9-13-26(24)35(29)30-22-10-6-7-11-23(22)31(37)38-30/h6-17,29-30,34H,18-19H2,1-5H3/t29-,30+/m1/s1 |
| InChIKey | NAVOUIBTHXWYGQ-IHLOFXLRSA-N |
| XLogP | 7.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |