C22H31N5O5 — CID 41003590
7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione (PubChem CID 41003590) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione.
| Compound Name | 7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 41003590 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 7-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione |
| SMILES | Cc1ccc(OC[C@H](O)Cn2c(NCCCOC(C)C)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H31N5O5/c1-14(2)31-11-5-10-23-21-24-19-18(20(29)25-22(30)26(19)4)27(21)12-16(28)13-32-17-8-6-15(3)7-9-17/h6-9,14,16,28H,5,10-13H2,1-4H3,(H,23,24)(H,25,29,30)/t16-/m1/s1 |
| InChIKey | OFNSFPGSPOSNCI-MRXNPFEDSA-N |
| XLogP | 1.40 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|