C23H32N6O5 — CID 7010771
7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione (PubChem CID 7010771) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione.
| Compound Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 7010771 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
| SMILES | Cc1ccc(OC[C@@H](O)Cn2c(NCCCN3CCOCC3)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H32N6O5/c1-16-4-6-18(7-5-16)34-15-17(30)14-29-19-20(27(2)23(32)26-21(19)31)25-22(29)24-8-3-9-28-10-12-33-13-11-28/h4-7,17,30H,3,8-15H2,1-2H3,(H,24,25)(H,26,31,32)/t17-/m0/s1 |
| InChIKey | DIWIFZYVEWODCR-KRWDZBQOSA-N |
| XLogP | 0.31 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|