C23H33N6O5+ — CID 7010770
7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione (PubChem CID 7010770) has the molecular formula C23H33N6O5+ and a molecular weight of 473.55 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione.
| Compound Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 7010770 |
| Molecular Formula | C23H33N6O5+ |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione |
| SMILES | Cc1ccc(OC[C@@H](O)Cn2c(NCCC[NH+]3CCOCC3)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H32N6O5/c1-16-4-6-18(7-5-16)34-15-17(30)14-29-19-20(27(2)23(32)26-21(19)31)25-22(29)24-8-3-9-28-10-12-33-13-11-28/h4-7,17,30H,3,8-15H2,1-2H3,(H,24,25)(H,26,31,32)/p+1/t17-/m0/s1 |
| InChIKey | DIWIFZYVEWODCR-KRWDZBQOSA-O |
| XLogP | -1.11 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|