C26H25N3O5S — CID 4100412
6-[(4-ethylphenyl)sulfamoyl]-N-[(2-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 4100412) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is 6-[(4-ethylphenyl)sulfamoyl]-N-[(2-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-[(4-ethylphenyl)sulfamoyl]-N-[(2-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 4100412 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 6-[(4-ethylphenyl)sulfamoyl]-N-[(2-methoxyphenyl)methyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccc3[nH]cc(C(=O)NCc4ccccc4OC)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C26H25N3O5S/c1-3-17-8-10-19(11-9-17)29-35(32,33)20-12-13-23-21(14-20)25(30)22(16-27-23)26(31)28-15-18-6-4-5-7-24(18)34-2/h4-14,16,29H,3,15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | AYSLJGYONNYGMH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |