C24H23N3O8 — CID 4100835
N-[3-[(2,6-dimethoxybenzoyl)amino]-4-nitrophenyl]-2,6-dimethoxybenzamide (PubChem CID 4100835) has the molecular formula C24H23N3O8 and a molecular weight of 481.46 g/mol. Its IUPAC name is N-[3-[(2,6-dimethoxybenzoyl)amino]-4-nitrophenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-[(2,6-dimethoxybenzoyl)amino]-4-nitrophenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 4100835 |
| Molecular Formula | C24H23N3O8 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[3-[(2,6-dimethoxybenzoyl)amino]-4-nitrophenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc([N+](=O)[O-])c(NC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C24H23N3O8/c1-32-17-7-5-8-18(33-2)21(17)23(28)25-14-11-12-16(27(30)31)15(13-14)26-24(29)22-19(34-3)9-6-10-20(22)35-4/h5-13H,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | FBPQXBZQWVRYOU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|