C8H12F3N3O2S — CID 4100957
propan-2-yl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate (PubChem CID 4100957) has the molecular formula C8H12F3N3O2S and a molecular weight of 271.26 g/mol. Its IUPAC name is propan-2-yl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate.
| Compound Name | propan-2-yl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 4100957 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | propan-2-yl 3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
| SMILES | CC(C)OC(=O)CC(=NNC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O2S/c1-4(2)16-6(15)3-5(8(9,10)11)13-14-7(12)17/h4H,3H2,1-2H3,(H3,12,14,17) |
| InChIKey | QTERFSBFOBPKNI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|