C18H17ClN4O3 — CID 41010203
N'-[(3R)-5-chloro-1-ethyl-2-oxo-3H-indol-3-yl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 41010203) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is N'-[(3R)-5-chloro-1-ethyl-2-oxo-3H-indol-3-yl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[(3R)-5-chloro-1-ethyl-2-oxo-3H-indol-3-yl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 41010203 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N'-[(3R)-5-chloro-1-ethyl-2-oxo-3H-indol-3-yl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | CCN1C(=O)[C@H](NC(=O)C(=O)NCc2cccnc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H17ClN4O3/c1-2-23-14-6-5-12(19)8-13(14)15(18(23)26)22-17(25)16(24)21-10-11-4-3-7-20-9-11/h3-9,15H,2,10H2,1H3,(H,21,24)(H,22,25)/t15-/m1/s1 |
| InChIKey | SPEAIZNFKXZSAE-OAHLLOKOSA-N |
| XLogP | 1.58 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|