C27H35N5O3 — CID 41023672
1-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-3-[1-(4-ethoxybenzoyl)piperidin-4-yl]urea (PubChem CID 41023672) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-3-[1-(4-ethoxybenzoyl)piperidin-4-yl]urea.
| Compound Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-3-[1-(4-ethoxybenzoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 41023672 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-3-[1-(4-ethoxybenzoyl)piperidin-4-yl]urea |
| SMILES | CCOc1ccc(C(=O)N2CCC(NC(=O)N[C@H](CC(C)C)c3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C27H35N5O3/c1-4-35-21-11-9-19(10-12-21)26(33)32-15-13-20(14-16-32)28-27(34)31-24(17-18(2)3)25-29-22-7-5-6-8-23(22)30-25/h5-12,18,20,24H,4,13-17H2,1-3H3,(H,29,30)(H2,28,31,34)/t24-/m1/s1 |
| InChIKey | NGIUNCPNDGRSAP-XMMPIXPASA-N |
| XLogP | 4.65 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |