C18H21NO5S — CID 41024761
9-[(3S)-1,1-dioxothiolan-3-yl]-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 41024761) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 9-[(3S)-1,1-dioxothiolan-3-yl]-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-[(3S)-1,1-dioxothiolan-3-yl]-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 41024761 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 9-[(3S)-1,1-dioxothiolan-3-yl]-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCc1cc(=O)oc2c3c(ccc12)OCN([C@H]1CCS(=O)(=O)C1)C3 |
| InChI | InChI=1S/C18H21NO5S/c1-2-3-12-8-17(20)24-18-14(12)4-5-16-15(18)9-19(11-23-16)13-6-7-25(21,22)10-13/h4-5,8,13H,2-3,6-7,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | YRTQNLPWJNVCGP-ZDUSSCGKSA-N |
| XLogP | 2.08 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|