C18H22NO3+ — CID 7646810
9-cyclopentyl-4-ethyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one (PubChem CID 7646810) has the molecular formula C18H22NO3+ and a molecular weight of 300.38 g/mol. Its IUPAC name is 9-cyclopentyl-4-ethyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one.
| Compound Name | 9-cyclopentyl-4-ethyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
|---|---|
| PubChem CID | 7646810 |
| Molecular Formula | C18H22NO3+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 9-cyclopentyl-4-ethyl-9,10-dihydro-8H-pyrano[2,3-f][1,3]benzoxazin-9-ium-2-one |
| SMILES | CCc1cc(=O)oc2c3c(ccc12)OC[NH+](C1CCCC1)C3 |
| InChI | InChI=1S/C18H21NO3/c1-2-12-9-17(20)22-18-14(12)7-8-16-15(18)10-19(11-21-16)13-5-3-4-6-13/h7-9,13H,2-6,10-11H2,1H3/p+1 |
| InChIKey | IOQMJMSNWDRDRU-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|