C15H13ClN2O — CID 4103570
2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]phenol (PubChem CID 4103570) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]phenol.
| Compound Name | 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 4103570 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]phenol |
| SMILES | Oc1ccccc1C1CC(c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C15H13ClN2O/c16-11-7-5-10(6-8-11)13-9-14(18-17-13)12-3-1-2-4-15(12)19/h1-8,14,18-19H,9H2 |
| InChIKey | ZOTJTRRGWVNLNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|