C20H20N4OS — CID 41038319
(2R)-2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-3-prop-2-enyl-1,2-dihydroquinazolin-4-one (PubChem CID 41038319) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (2R)-2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-3-prop-2-enyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-3-prop-2-enyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 41038319 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2R)-2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-3-prop-2-enyl-1,2-dihydroquinazolin-4-one |
| SMILES | C=CCN1C(=O)c2ccccc2N[C@H]1c1cc(C)n(-c2nccs2)c1C |
| InChI | InChI=1S/C20H20N4OS/c1-4-10-23-18(22-17-8-6-5-7-15(17)19(23)25)16-12-13(2)24(14(16)3)20-21-9-11-26-20/h4-9,11-12,18,22H,1,10H2,2-3H3/t18-/m1/s1 |
| InChIKey | BPULINVRXNNXDW-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|