C20H29N3O6S — CID 41041869
(2S)-N-cycloheptyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)pentanediamide (PubChem CID 41041869) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)pentanediamide.
| Compound Name | (2S)-N-cycloheptyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)pentanediamide |
|---|---|
| PubChem CID | 41041869 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (2S)-N-cycloheptyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)pentanediamide |
| SMILES | NC(=O)CC[C@H](NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H29N3O6S/c21-19(24)10-8-16(20(25)22-14-5-3-1-2-4-6-14)23-30(26,27)15-7-9-17-18(13-15)29-12-11-28-17/h7,9,13-14,16,23H,1-6,8,10-12H2,(H2,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | HROPKPKCXNHESO-INIZCTEOSA-N |
| XLogP | 1.21 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |