C13H12N4O6S2 — CID 41043078
ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate (PubChem CID 41043078) has the molecular formula C13H12N4O6S2 and a molecular weight of 384.40 g/mol. Its IUPAC name is ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 41043078 |
| Molecular Formula | C13H12N4O6S2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C(\C)c1ccc(-c2sc([N+](=O)[O-])cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H12N4O6S2/c1-3-23-13(18)15-14-7(2)9-4-5-10(24-9)12-8(16(19)20)6-11(25-12)17(21)22/h4-6H,3H2,1-2H3,(H,15,18)/b14-7+ |
| InChIKey | SWSPDZRPNXUWAI-VGOFMYFVSA-N |
| XLogP | 3.76 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|