About ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate
ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate (PubChem CID 41043078) has the molecular formula C13H12N4O6S2
and a molecular weight of 384.40 g/mol. Its IUPAC name is ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate |
| PubChem CID | 41043078 |
| Molecular Formula | C13H12N4O6S2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C(\C)c1ccc(-c2sc([N+](=O)[O-])cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H12N4O6S2/c1-3-23-13(18)15-14-7(2)9-4-5-10(24-9)12-8(16(19)20)6-11(25-12)17(21)22/h4-6H,3H2,1-2H3,(H,15,18)/b14-7+ |
| InChIKey | SWSPDZRPNXUWAI-VGOFMYFVSA-N |
| XLogP | 3.76 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate?
The IUPAC name of ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate (CID 41043078) is ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate.
What is the SMILES notation for ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate?
The canonical SMILES for ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate is CCOC(=O)N/N=C(\C)c1ccc(-c2sc([N+](=O)[O-])cc2[N+](=O)[O-])s1.
What is the InChIKey of ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate?
The InChIKey is SWSPDZRPNXUWAI-VGOFMYFVSA-N. The full InChI is InChI=1S/C13H12N4O6S2/c1-3-23-13(18)15-14-7(2)9-4-5-10(24-9)12-8(16(19)20)6-11(25-12)17(21)22/h4-6H,3H2,1-2H3,(H,15,18)/b14-7+.
What are the key properties of ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate?
ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate has a molecular weight of 384.40 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]carbamate is sourced from PubChem (CID 41043078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).