C23H18FN3S3 — CID 41043803
N-[(6R)-3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-fluoro-1,3-benzothiazol-2-amine (PubChem CID 41043803) has the molecular formula C23H18FN3S3 and a molecular weight of 451.62 g/mol. Its IUPAC name is N-[(6R)-3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-[(6R)-3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 41043803 |
| Molecular Formula | C23H18FN3S3 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-[(6R)-3-(1,3-benzothiazol-2-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-fluoro-1,3-benzothiazol-2-amine |
| SMILES | C[C@@H]1CCc2c(sc(Nc3nc4ccc(F)cc4s3)c2-c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C23H18FN3S3/c1-12-6-8-14-18(10-12)29-22(20(14)21-25-15-4-2-3-5-17(15)28-21)27-23-26-16-9-7-13(24)11-19(16)30-23/h2-5,7,9,11-12H,6,8,10H2,1H3,(H,26,27)/t12-/m1/s1 |
| InChIKey | YOXFXRWKPXLUAX-GFCCVEGCSA-N |
| XLogP | 7.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |