C24H21N3OS3 — CID 43968512
N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 43968512) has the molecular formula C24H21N3OS3 and a molecular weight of 463.65 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43968512 |
| Molecular Formula | C24H21N3OS3 |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3sc4c(c3-c3nc5ccccc5s3)CCCCC4)sc2c1 |
| InChI | InChI=1S/C24H21N3OS3/c1-28-14-11-12-17-20(13-14)31-24(26-17)27-23-21(15-7-3-2-4-9-18(15)29-23)22-25-16-8-5-6-10-19(16)30-22/h5-6,8,10-13H,2-4,7,9H2,1H3,(H,26,27) |
| InChIKey | YWPJHWLYLHIGNR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |