C23H19N3OS3 — CID 43968968
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-methoxy-1,3-benzothiazol-2-amine (PubChem CID 43968968) has the molecular formula C23H19N3OS3 and a molecular weight of 449.63 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43968968 |
| Molecular Formula | C23H19N3OS3 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2sc(Nc3sc4c(c3-c3nc5ccccc5s3)CCCC4)nc2c1 |
| InChI | InChI=1S/C23H19N3OS3/c1-27-13-10-11-19-16(12-13)25-23(30-19)26-22-20(14-6-2-4-8-17(14)28-22)21-24-15-7-3-5-9-18(15)29-21/h3,5,7,9-12H,2,4,6,8H2,1H3,(H,25,26) |
| InChIKey | SIHHKCCFSWLZET-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |