C18H15F3N2S — CID 4105276
5-(4-ethylphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazole-2-thione (PubChem CID 4105276) has the molecular formula C18H15F3N2S and a molecular weight of 348.39 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazole-2-thione.
| Compound Name | 5-(4-ethylphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 4105276 |
| Molecular Formula | C18H15F3N2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-(4-ethylphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
| SMILES | CCc1ccc(-c2cn(-c3cccc(C(F)(F)F)c3)c(=S)[nH]2)cc1 |
| InChI | InChI=1S/C18H15F3N2S/c1-2-12-6-8-13(9-7-12)16-11-23(17(24)22-16)15-5-3-4-14(10-15)18(19,20)21/h3-11H,2H2,1H3,(H,22,24) |
| InChIKey | SGIIFPVJWXZCDL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|