C24H29N3O6S — CID 41052908
2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 41052908) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41052908 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-1-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | C/C(=N/OCC(=O)N1CCN(S(=O)(=O)c2c(C)cc(C)cc2C)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H29N3O6S/c1-16-11-17(2)24(18(3)12-16)34(29,30)27-9-7-26(8-10-27)23(28)14-33-25-19(4)20-5-6-21-22(13-20)32-15-31-21/h5-6,11-13H,7-10,14-15H2,1-4H3/b25-19- |
| InChIKey | YQYPTBJCYCWUQG-PLRJNAJWSA-N |
| XLogP | 2.61 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|