C26H32N2O4S — CID 41057617
N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5-propan-2-yl-1-benzofuran-3-yl)acetamide (PubChem CID 41057617) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5-propan-2-yl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5-propan-2-yl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 41057617 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5-propan-2-yl-1-benzofuran-3-yl)acetamide |
| SMILES | CC(C)c1ccc2occ(CC(=O)N(Cc3ccc(N(C)C)cc3)[C@H]3CCS(=O)(=O)C3)c2c1 |
| InChI | InChI=1S/C26H32N2O4S/c1-18(2)20-7-10-25-24(13-20)21(16-32-25)14-26(29)28(23-11-12-33(30,31)17-23)15-19-5-8-22(9-6-19)27(3)4/h5-10,13,16,18,23H,11-12,14-15,17H2,1-4H3/t23-/m0/s1 |
| InChIKey | XKDMXTPRWIADHJ-QHCPKHFHSA-N |
| XLogP | 4.38 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|