C23H25FN2O4S — CID 18860692
N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide (PubChem CID 18860692) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18860692 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
| SMILES | CN(C)c1ccc(CN(C(=O)Cc2coc3ccc(F)cc23)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H25FN2O4S/c1-25(2)19-6-3-16(4-7-19)13-26(20-9-10-31(28,29)15-20)23(27)11-17-14-30-22-8-5-18(24)12-21(17)22/h3-8,12,14,20H,9-11,13,15H2,1-2H3 |
| InChIKey | WEMYMRZQKOIZDG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|