C21H27N3O6S — CID 41070554
(2S)-2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 41070554) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | (2S)-2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 41070554 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyanilino)-N-(3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(N[C@@H](C)C(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1OC |
| InChI | InChI=1S/C21H27N3O6S/c1-15(22-17-7-8-19(28-2)20(14-17)29-3)21(25)23-16-5-4-6-18(13-16)31(26,27)24-9-11-30-12-10-24/h4-8,13-15,22H,9-12H2,1-3H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | FCCJVYFZBSSILV-HNNXBMFYSA-N |
| XLogP | 2.16 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|