C22H29N3O4S — CID 41075600
(3R,9bS)-N-[(2S,3R)-3-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 41075600) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (3R,9bS)-N-[(2S,3R)-3-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[(2S,3R)-3-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 41075600 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (3R,9bS)-N-[(2S,3R)-3-methyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]pentan-2-yl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)[C@@H]1CS[C@H]2c3ccccc3C(=O)N12)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H29N3O4S/c1-3-13(2)18(20(27)23-11-14-7-6-10-29-14)24-19(26)17-12-30-22-16-9-5-4-8-15(16)21(28)25(17)22/h4-5,8-9,13-14,17-18,22H,3,6-7,10-12H2,1-2H3,(H,23,27)(H,24,26)/t13-,14+,17+,18+,22+/m1/s1 |
| InChIKey | PDSJGGLQYLHPKJ-IDBYTSBWSA-N |
| XLogP | 2.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |