About [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate (PubChem CID 41075754) has the molecular formula C21H17ClN4O4
and a molecular weight of 424.84 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate |
| PubChem CID | 41075754 |
| Molecular Formula | C21H17ClN4O4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate |
| SMILES | CCCn1nc(C(=O)OCc2nnc(-c3ccc(Cl)cc3)o2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H17ClN4O4/c1-2-11-26-20(27)16-6-4-3-5-15(16)18(25-26)21(28)29-12-17-23-24-19(30-17)13-7-9-14(22)10-8-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | HVGFNPUTCYZXGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate?
The IUPAC name of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate (CID 41075754) is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate.
What is the SMILES notation for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate?
The canonical SMILES for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate is CCCn1nc(C(=O)OCc2nnc(-c3ccc(Cl)cc3)o2)c2ccccc2c1=O.
What is the InChIKey of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate?
The InChIKey is HVGFNPUTCYZXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O4/c1-2-11-26-20(27)16-6-4-3-5-15(16)18(25-26)21(28)29-12-17-23-24-19(30-17)13-7-9-14(22)10-8-13/h3-10H,2,11-12H2,1H3.
What are the key properties of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate?
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate has a molecular weight of 424.84 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-oxo-3-propylphthalazine-1-carboxylate is sourced from PubChem (CID 41075754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).